CymitQuimica logo

CAS 64036-86-8

:

(16E)-4,5,6,9,10,11,13,14,15,18,19,19a-dodecahydro-1H-6,9-methano[1]benzofuro[3,2-o][1,5,11]triazacyclohenicosine-3,12,22(2H)-trione hydrochloride

Description:
The chemical substance with the name "(16E)-4,5,6,9,10,11,13,14,15,18,19,19a-dodecahydro-1H-6,9-methano[1]benzofuro[3,2-o][1,5,11]triazacyclohenicosine-3,12,22(2H)-trione hydrochloride" and CAS number "64036-86-8" is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings and nitrogen-containing heterocycles. This compound features a triazacyclo structure, indicating the presence of three nitrogen atoms within a cyclic framework, contributing to its potential biological activity. The presence of multiple functional groups, including triones, suggests that it may exhibit reactivity typical of carbonyl compounds. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. However, specific details regarding its biological activity, toxicity, and practical applications would require further investigation and research.
Formula:C25H32ClN3O4
InChI:InChI=1/C25H31N3O4.ClH/c29-19-7-8-22-21-9-10-25(31)28-14-17-5-6-18(12-17)27-16-20(30)15-26-11-3-1-2-4-23(21)32-24(22)13-19;/h1,3,5-8,13,17-18,23,26-27H,2,4,9-12,14-16H2,(H,28,31);1H/b3-1+;
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.