CAS 64037-07-6
:5-Bromo-2-benzoxazolamine
Description:
5-Bromo-2-benzoxazolamine is an organic compound characterized by its heterocyclic structure, which includes a benzoxazole ring fused with an amine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine substituent. The bromine atom can influence the compound's reactivity, making it a useful intermediate in various chemical syntheses, particularly in medicinal chemistry and material science. The presence of the amine group suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Additionally, compounds like 5-Bromo-2-benzoxazolamine may exhibit fluorescence properties, making them valuable in analytical applications. Its specific applications can vary, but it is often explored for its potential in drug development and as a building block in organic synthesis. As with many chemical substances, safety and handling precautions are essential due to the potential toxicity associated with brominated compounds.
Formula:C7H5BrN2O
InChI:InChI=1/C7H5BrN2O/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H,(H2,9,10)
InChI key:InChIKey=HMRSJGDFTOUVBW-UHFFFAOYSA-N
SMILES:NC=1OC=2C(N1)=CC(Br)=CC2
Synonyms:- 2-Amino-5-Bromo-Benzoxazol
- 2-Benzoxazolamine, 5-Bromo-
- 5-Bromo-2-benzoxazolamine
- 5-Bromobenzo[D]Oxazol-2-Amine
- Benzoxazole, 2-amino-5-bromo-
- NSC 24982
- 5-Bromo-1,3-benzoxazol-2-amine
- 2-AMino-5-broMobenzoxazole
- 5-BROMO-2-BENZO[D]OXAZOLAMINE
- EOS-60501
- 5-bromobenzo[b]oxazol-2-amine
- 15-BROMOBENZO[D]OXAZOL-2-AMINE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-1,3-benzoxazol-2-amine
CAS:Formula:C7H5BrN2OPurity:98%Color and Shape:SolidMolecular weight:213.0314Ref: IN-DA00373C
1kgTo inquire250gTo inquire500gTo inquire1g29.00€250mg29.00€5g62.00€10g88.00€25g166.00€5-Bromobenzo[d]oxazol-2-amine
CAS:5-Bromobenzo[d]oxazol-2-aminePurity:98%Molecular weight:213.03g/mol5-Bromobenzo[d]oxazol-2-amine
CAS:Formula:C7H5BrN2OPurity:95%Color and Shape:Solid, Brown powderMolecular weight:213.0345-Bromobenzo[d]oxazol-2-amine
CAS:5-Bromobenzo[d]oxazol-2-amine is a chemical that is used in the treatment of cancer. It is synthesized from benzoic acid and bromoacetonitrile. 5-Bromobenzo[d]oxazol-2-amine is an anticancer agent that has been shown to have a depressant activity on animal tissues, which may be due to its ability to neutralize cyanogen chloride, a chemical that reacts with organic solvents and produces toxic gases such as hydrogen cyanide. This drug also binds to DNA, preventing cell growth and causing cell death. 5-Bromobenzo[d]oxazol-2-amine can be used to treat cancer cells in mice and has been shown to inhibit the proliferation of MCT7 cells. It also inhibits the growth of human breast cancer cells by blocking protein synthesis at the ribosome level.Formula:C7H5BrN2OPurity:Min. 95%Molecular weight:213.03 g/mol



