CAS 64037-51-0
:2-[4,4-di(thiophen-2-yl)but-3-en-2-yl]pyridine hydrochloride (1:1)
Description:
2-[4,4-Di(thiophen-2-yl)but-3-en-2-yl]pyridine hydrochloride (1:1), with CAS number 64037-51-0, is a chemical compound characterized by its unique structure that includes a pyridine ring and a butenyl side chain substituted with thiophene groups. This compound typically exhibits properties associated with both organic and heterocyclic compounds, including potential applications in organic electronics, such as organic semiconductors or photovoltaic materials, due to the presence of conjugated systems. The hydrochloride form indicates that it is a salt, which can enhance its solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of thiophene moieties contributes to its electronic properties, potentially allowing for charge transport and light absorption. Additionally, the compound may exhibit interesting optical properties, making it a candidate for research in materials science and photonics. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled.
Formula:C17H16ClNS2
InChI:InChI=1/C17H15NS2.ClH/c1-13(15-6-2-3-9-18-15)12-14(16-7-4-10-19-16)17-8-5-11-20-17;/h2-13H,1H3;1H
SMILES:CC(C=C(c1cccs1)c1cccs1)c1ccccn1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Piperidylthiambutene hydrochloride
CAS:Piperidylthiambutene hydrochloride is an opioid compound that exhibits analgesic effects in animal models.Formula:C17H22ClNS2Color and Shape:SolidMolecular weight:339.95Piperidylthiambutene hydrochloride
CAS:Controlled Product<p>Please enquire for more information about Piperidylthiambutene hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C17H21NS2·HClPurity:Min. 95%Molecular weight:303.48 g/molPiperidylthiambutene Hydrochloride
CAS:Controlled ProductFormula:C17H21NS2·HClColor and Shape:NeatMolecular weight:339.95


