CAS 64039-28-7
:Dehydroaceticacidsodiumsalt; 98%
Description:
Dehydroacetic acid sodium salt, with the CAS number 64039-28-7, is a sodium salt derivative of dehydroacetic acid, a compound known for its antimicrobial and preservative properties. This substance typically appears as a white to off-white crystalline powder and is soluble in water, making it suitable for various applications in cosmetic and pharmaceutical formulations. It is often used as a preservative due to its effectiveness against a broad spectrum of microorganisms, including bacteria and fungi. The compound is characterized by its stability under a range of pH conditions, which enhances its utility in formulations that require a longer shelf life. Additionally, dehydroacetic acid sodium salt is considered to have low toxicity, making it a favorable choice in products intended for skin contact. Its use is regulated in many regions, and it is essential to adhere to safety guidelines when handling and incorporating it into formulations. Overall, this compound plays a significant role in enhancing the stability and safety of various products in the personal care and pharmaceutical industries.
Formula:C8H9NaO5
InChI:InChI=1/C8H8O4.Na.H2O/c1-4-3-6(10)7(5(2)9)8(11)12-4;;/h3,11H,1-2H3;;1H2/q;+1;/p-1
Synonyms:- Dehydroacetic acid sodium salt
- sodium 3-acetyl-6-methyl-4-oxo-4H-pyran-2-olate hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Sodium Dehydroacetate Monohydrate
CAS:Formula:C8H7NaO4·H2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:208.15Sodium Dehydroacetate Monohydrate
CAS:Formula:C8H9NaO5Purity:98%Color and Shape:SolidMolecular weight:208.1438Dehydroacetic Acid Sodium Salt Monohydrate
CAS:<p>Dehydroacetic Acid Sodium Salt Monohydrate</p>Purity:99%Molecular weight:208.14g/mol


