CAS 64040-47-7
:4-amino-N-{1-[(5S,6R)-5-{[4,6-dideoxy-4-(methylamino)-alpha-D-glucopyranosyl]oxy}-6-methyltetrahydro-2H-pyran-2-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}benzamide
Description:
The chemical substance known as 4-amino-N-{1-[(5S,6R)-5-{[4,6-dideoxy-4-(methylamino)-alpha-D-glucopyranosyl]oxy}-6-methyltetrahydro-2H-pyran-2-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}benzamide, with the CAS number 64040-47-7, is a complex organic compound characterized by its multi-functional structure. It features an amino group, a benzamide moiety, and a pyrimidine derivative, indicating potential biological activity. The presence of a glucopyranosyl unit suggests it may interact with biological systems, possibly influencing glycosylation processes. The stereochemistry indicated by the (5S,6R) configuration implies specific spatial arrangements that can affect the compound's reactivity and interaction with biological targets. This compound may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutics targeting specific enzymes or receptors. Further studies would be necessary to elucidate its pharmacological profile and potential therapeutic uses.
Formula:C24H33N5O7
InChI:InChI=1/C24H33N5O7/c1-12-16(36-23-21(31)20(30)19(26-3)13(2)35-23)8-9-18(34-12)29-11-10-17(28-24(29)33)27-22(32)14-4-6-15(25)7-5-14/h4-7,10-13,16,18-21,23,26,30-31H,8-9,25H2,1-3H3,(H,27,28,32,33)/t12-,13-,16+,18?,19-,20+,21-,23-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Norplicacetin
CAS:<p>Norplicacetin exhibits activity against Gram-positive bacteria and mycobacteria.</p>Formula:C24H33N5O7Molecular weight:503.55

