CAS 64052-90-0

5'-methoxy-2',3'-dihydrospiro[cyclohexane-1,1'-indene]-4,7'-diol

Description:

5'-Methoxy-2',3'-dihydrospiro[cyclohexane-1,1'-indene]-4,7'-diol is a complex organic compound characterized by its unique spirocyclic structure, which consists of a cyclohexane ring fused to an indene moiety. This compound features two hydroxyl (-OH) groups and a methoxy (-OCH3) substituent, contributing to its potential reactivity and solubility properties. The presence of the diol functional groups suggests that it may participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility in polar solvents. The methoxy group can also affect the compound's electronic properties and reactivity, potentially making it a candidate for various chemical reactions or applications in organic synthesis. Additionally, the spiro structure may impart unique steric and electronic characteristics, which could be relevant in biological or medicinal chemistry contexts. Overall, this compound's structural features suggest it may have interesting chemical behavior and potential applications in research or industry, although specific applications would depend on further studies and evaluations.

Formula: C₁₅H₂₀O₃

InChI: InChI=1/C15H20O3/c1-18-12-8-10-2-5-15(14(10)13(17)9-12)6-3-11(16)4-7-15/h8-9,11,16-17H,2-7H2,1H3

SMILES: COc1cc2CCC3(CCC(CC3)O)c2c(c1)O

Synonyms:

• Spiro(cyclohexane-1,1'-(1H)indene)-4,7'-diol, 2',3'-dihydro-5'-methoxy-, cis-

β-cannabispiranol

CAS: 64052-90-0

Formula: C₁₅H₂₀O₃

Purity: 98.0%

Molecular weight: 248.3175

Ref: IN-DA00EGTR

Cannabispirol

CAS: 64052-90-0

Cannabispirol has a weak antibacterial effect which is more definite on plasmid carrying bacteria than plasmidless ones, and inhibits intercellular plasmid

Formula: C₁₅H₂₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.32

Ref: TM-TN3580

Cannabispirol

CAS: 64052-90-0

Formula: C₁₅H₂₀O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 248.322

Ref: BP-SBP02251

Cannabispirol

CAS: 64052-90-0

Please enquire for more information about Cannabispirol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₂₀O₃

Purity: Min. 95%

Molecular weight: 248.32 g/mol

Ref: 3D-PCA05290