CAS 64058-39-5

(2E)-3-chloroprop-2-en-1-yl 2-hydroxypropanoate

Description:

(2E)-3-chloroprop-2-en-1-yl 2-hydroxypropanoate, with the CAS number 64058-39-5, is an organic compound characterized by its ester functional group and a chloropropene moiety. This compound features a double bond between the second and third carbon atoms, indicating it is an alkene, and a hydroxyl group (-OH) attached to a propanoate structure, which contributes to its reactivity and solubility in polar solvents. The presence of chlorine in the structure enhances its electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The compound is likely to exhibit moderate stability under standard conditions but may undergo hydrolysis or other reactions in the presence of strong acids or bases. Its unique structure suggests potential applications in organic synthesis, particularly in the development of agrochemicals or pharmaceuticals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₆H₉ClO₃

InChI: InChI=1/C6H9ClO3/c1-5(8)6(9)10-4-2-3-7/h2-3,5,8H,4H2,1H3/b3-2+

Synonyms:

• propanoic acid, 2-hydroxy-, (2E)-3-chloro-2-propen-1-yl ester
• (2E)-3-Chloroprop-2-en-1-yl 2-hydroxypropanoate

3-Chloroprop-2-en-1-yl 2-hydroxypropanoate

CAS: 64058-39-5

Versatile small molecule scaffold

Formula: C₆H₉ClO₃

Purity: Min. 95%

Molecular weight: 164.59 g/mol

Ref: 3D-PCA05839