CAS 64065-08-3

Bis(dimethylphosphino)methane

Description:

Bis(dimethylphosphino)methane, with the CAS number 64065-08-3, is a bidentate ligand characterized by its two dimethylphosphino groups attached to a central methane carbon. This compound is typically a colorless to pale yellow liquid and is known for its strong coordination ability with transition metals, making it valuable in various catalytic processes and organometallic chemistry. The presence of phosphorus atoms contributes to its unique electronic properties, enhancing its reactivity and stability in coordination complexes. Bis(dimethylphosphino)methane exhibits good solubility in organic solvents, which facilitates its use in synthetic applications. Additionally, it can participate in various chemical reactions, including those involving metal complexes, due to its ability to donate electron pairs. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested. Overall, its distinctive structure and properties make it an important compound in the field of coordination chemistry and catalysis.

Formula: C₅H₁₄P₂

InChI: InChI=1/C5H14P2/c1-6(2)5-7(3)4/h5H2,1-4H3

SMILES: CP(C)CP(C)C

Synonyms:

• Methanediylbis(Dimethylphosphane)

Bis(Dimethylphosphino)methane

CAS: 64065-08-3

Formula: C₅H₁₄P₂

Molecular weight: 136.1122

Ref: IN-DA003OAS

Bis(dimethylphosphino)methane, min. 98%

CAS: 64065-08-3

Bis(dimethylphosphino)methane, min. 98%

Formula: (CH₃)₂PCH₂P(CH₃)₂

Purity: min. 98%

Color and Shape: colorless liq.

Molecular weight: 136.12

Ref: 08-15-0093