CAS 6407-19-8
:2-chloro-N-(2-chloroethyl)-N-methyl-2-phenylethanamine
Description:
2-Chloro-N-(2-chloroethyl)-N-methyl-2-phenylethanamine, with the CAS number 6407-19-8, is a chemical compound that belongs to the class of amines. It features a phenylethanamine backbone, which is substituted with two chloro groups and a methyl group. This compound is characterized by its potential use in various chemical syntheses and may exhibit biological activity due to its amine functional group. The presence of chlorine atoms can influence its reactivity and solubility, making it a subject of interest in medicinal chemistry and material science. Its structure suggests that it may interact with biological systems, potentially affecting neurotransmitter pathways or serving as a precursor in the synthesis of other compounds. However, specific safety and handling guidelines should be followed, as halogenated amines can pose health risks. As with many chemical substances, understanding its properties, including stability, reactivity, and potential applications, is crucial for safe and effective use in research and industry.
Formula:C11H15Cl2N
InChI:InChI=1/C11H15Cl2N/c1-14(8-7-12)9-11(13)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3
SMILES:CN(CCCl)CC(c1ccccc1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Mirtazapine Impurity 5 HCl
CAS:Formula:C11H15Cl2N·HClColor and Shape:White To Off-White SolidMolecular weight:232.15 36.46

