CAS 640725-74-2
:6-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine
Description:
6-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine, with CAS number 640725-74-2, is a purine derivative characterized by its structural features that include a chlorinated purine base and a ribofuranosyl sugar moiety. This compound exhibits properties typical of nucleosides, such as the ability to participate in hydrogen bonding due to the presence of amino and hydroxyl groups. The chlorination at the 6-position of the purine ring may influence its biological activity and stability, potentially affecting its interactions with enzymes and nucleic acids. The C-methyl substitution on the ribofuranosyl sugar enhances its lipophilicity, which can impact cellular uptake and pharmacokinetics. This compound may be of interest in medicinal chemistry and biochemistry, particularly in the development of antiviral or anticancer agents, as modifications to nucleosides often lead to compounds with enhanced therapeutic properties. Its solubility, stability, and reactivity would be influenced by the specific functional groups present, making it a subject of study in various chemical and biological contexts.
Formula:C11H14ClN5O4
InChI:InChI=1S/C11H14ClN5O4/c1-11(20)6(19)4(2-18)21-9(11)17-3-14-5-7(12)15-10(13)16-8(5)17/h3-4,6,9,18-20H,2H2,1H3,(H2,13,15,16)/t4-,6-,9-,11-/m1/s1
InChI key:InChIKey=WARIDGHHZMLANX-GITKWUPZSA-N
SMILES:C[C@]1(O)[C@H](N2C=3C(N=C2)=C(Cl)N=C(N)N3)O[C@H](CO)[C@H]1O
Synonyms:- 9H-Purin-2-amine, 6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-
- 6-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine
CAS:2-Amino-6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine is a 2'-C-Methyl nucleoside; Halo-nucleoside.Formula:C11H14ClN5O4Color and Shape:SolidMolecular weight:315.71
