CAS 640769-71-7

2-(Pyrimidin-5-yl)benzaldehyde

Description:

2-(Pyrimidin-5-yl)benzaldehyde is an organic compound characterized by the presence of both a pyrimidine and a benzaldehyde functional group. It features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3, and a benzaldehyde moiety, which consists of a benzene ring with a formyl group (-CHO) attached. This compound typically exhibits properties such as being a pale yellow to light brown solid, with a moderate melting point and solubility in organic solvents like ethanol and dichloromethane. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity associated with both the pyrimidine and aldehyde functionalities. Additionally, it may serve as an intermediate in organic synthesis, facilitating the formation of more complex molecules. The compound's reactivity is influenced by the electron-withdrawing nature of the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions.

Formula: C₁₁H₈N₂O

InChI: InChI=1/C11H8N2O/c14-7-9-3-1-2-4-11(9)10-5-12-8-13-6-10/h1-8H

SMILES: c1ccc(c(c1)C=O)c1cncnc1

Synonyms:

• 2-(5-Pyrimidinyl)benzaldehyde
• AKOS BAR-0660
• 2-PYRIMIDIN-5-YLBENZALDEHYDE

Benzaldehyde, 2-(5-pyrimidinyl)-

CAS: 640769-71-7

Formula: C₁₁H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.1940

Ref: IN-DA00IBBH

2-(5-Pyrimidinyl)benzaldehyde

CAS: 640769-71-7

Formula: C₁₁H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.198

Ref: 10-F039432