CAS 64078-09-7

1-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-[(dimethylamino)methyl]-N-ethyl-1H-1,2,4-triazole-3-carboxamide

Description:

1-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-[(dimethylamino)methyl]-N-ethyl-1H-1,2,4-triazole-3-carboxamide, with CAS number 64078-09-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring, a carboxamide functional group, and multiple aromatic substituents. This compound exhibits properties typical of triazole derivatives, such as potential antifungal and antimicrobial activities, making it of interest in pharmaceutical research. The presence of chlorine atoms in its structure may enhance its biological activity and influence its solubility and stability. Additionally, the dimethylamino group can contribute to its lipophilicity, potentially affecting its pharmacokinetics. The compound's synthesis involves multi-step reactions, and its characterization typically includes techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of triazole-based agents that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₂₁H₂₁Cl₂N₅O₂

InChI: InChI=1/C21H21Cl2N5O2/c1-4-24-21(30)20-25-18(12-27(2)3)28(26-20)17-10-9-13(22)11-15(17)19(29)14-7-5-6-8-16(14)23/h5-11H,4,12H2,1-3H3,(H,24,30)

SMILES: CCNC(=O)c1nc(CN(C)C)n(c2ccc(cc2C(=O)c2ccccc2Cl)Cl)n1

CGP11952

CAS: 64078-09-7

CGP11952 is a peptide-based activator of ion channels. It binds to the receptor site and activates the ion channel, which increases the flow of ions through the membrane. This leads to depolarization in excitable cells, such as neurons. CGP11952 is a very high purity product that can be used as a research tool or cell biology inhibitor.

Formula: C₂₁H₂₁Cl₂N₅O₂

Purity: Min. 95%

Molecular weight: 446.3 g/mol

Ref: 3D-PCA07809

CGP11952

CAS: 64078-09-7

CGP11952 is same the benzodiazepines in its pharmacological action and it also is an experimental benzodiazepine derivative.

Formula: C₂₁H₂₁Cl₂N₅O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 446.33

Ref: TM-T14940