CAS 6409-58-1

1-acetyl-10a,12a-dimethyl-2-oxo-1,2,3,4,4a,4b,5,7,8,9,10,10a,10b,11,12,12a-hexadecahydronaphtho[2,1-f]quinolin-8-yl acetate

Description:

1-Acetyl-10a,12a-dimethyl-2-oxo-1,2,3,4,4a,4b,5,7,8,9,10,10a,10b,11,12,12a-hexadecahydronaphtho[2,1-f]quinolin-8-yl acetate, with CAS number 6409-58-1, is a complex organic compound characterized by its intricate polycyclic structure, which includes a naphthoquinoline framework. This compound features multiple functional groups, including an acetyl group and an acetate moiety, contributing to its reactivity and potential biological activity. The presence of multiple methyl groups suggests a degree of steric hindrance, which may influence its interactions with biological targets. The hexadecahydronaphtho structure indicates a saturated polycyclic system, which can affect its solubility and stability. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antitumor or antimicrobial activities. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₂₃H₃₃NO₄

InChI: InChI=1/C23H33NO4/c1-14(25)24-21(27)8-7-20-18-6-5-16-13-17(28-15(2)26)9-11-22(16,3)19(18)10-12-23(20,24)4/h5,17-20H,6-13H2,1-4H3

SMILES: CC(=O)N1C(=O)CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(=O)C

Calcium Dobesilate Impurity 18

CAS: 6409-58-1

Formula: C₆H₆O₅S

Molecular weight: 190.17

Ref: 4Z-D-8324

2,4-Dihydroxybenzenesulfonic acid

CAS: 6409-58-1

2,4-Dihydroxybenzenesulfonic acid is a chemical compound that is used as a polymerization catalyst. It is most commonly used in the production of polyoxyethylene and copolymers. The catalytic activity of 2,4-dihydroxybenzenesulfonic acid is due to its acid group and hydroxy groups. This chemical can also be prepared by the reaction of resorcinol and hydrogen peroxide. The fluidity of this compound can be increased by adding an appropriate fluidizing agent such as peroxide or ammonium persulfate.

Formula: C₆H₆O₅S

Purity: Min. 95%

Molecular weight: 190.17 g/mol

Ref: 3D-FD32967