CAS 64091-90-3
:4-(Methylnitrosamino)-4-(3-pyridyl)butanal
Description:
4-(Methylnitrosamino)-4-(3-pyridyl)butanal, commonly referred to as a nitrosamine compound, is characterized by its complex structure that includes a pyridine ring and a nitrosamino group. This compound is known for its potential carcinogenic properties, particularly in the context of tobacco products, where it can form during the curing and processing of tobacco. The presence of the methylnitrosamino group is significant as it is associated with the formation of DNA adducts, which can lead to mutations and cancer development. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and exhibits stability under certain conditions, although it can decompose when exposed to heat or light. Due to its toxicological profile, 4-(Methylnitrosamino)-4-(3-pyridyl)butanal is of considerable interest in research related to cancer biology and public health, particularly in understanding the risks associated with tobacco consumption.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-13(12-15)10(5-3-7-14)9-4-2-6-11-8-9/h2,4,6-8,10H,3,5H2,1H3
InChI key:InChIKey=FRJHUNPWTKLYGL-UHFFFAOYSA-N
SMILES:C(CCC=O)(N(N=O)C)C=1C=CC=NC1
Synonyms:- 1-(N-Methyl-N-nitrosamino)-1-(3-pyridinyl)-4-butanal
- 4-(Methylnitrosamino)-4-(3-pyridyl)butanal
- 4-(N-Methyl-N-nitrosamino)-4-(3-pyridyl)-1-butanal
- 4-(N-Methyl-N-nitrosamino)-4-(3-pyridyl)butanal
- γ-(Methylnitrosoamino)-3-pyridinebutanal
- 3-Pyridinebutanal, γ-(methylnitrosoamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(N-Methyl-N-nitrosamino)-4-(3-pyridyl)butanal
CAS:Controlled Product<p>Applications A tobacco smoke-derived nitrosamine which is activated by multiple human cytochrome P 450s including the polymorphic human cytochrome P 4502D6.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Castonguay, A., et al.: Cancer Lett., 46, 93 (1989), Crespi, C.L., et al.: Carcinogenesis, 12, 1197 (1991),<br></p>Formula:C10H13N3O2Color and Shape:Light Brown LiquidMolecular weight:207.23

