CAS 64095-60-9
:Longistylin A
Description:
Longistylin A, with the CAS number 64095-60-9, is a natural compound classified as a flavonoid, specifically a flavonol glycoside. It is primarily derived from certain plant species, particularly those in the genus *Longistylis*. This compound is characterized by its complex structure, which typically includes a flavonoid backbone with sugar moieties attached, contributing to its solubility and biological activity. Longistylin A has garnered interest in the field of medicinal chemistry due to its potential antioxidant, anti-inflammatory, and anticancer properties. Its biological activities are attributed to its ability to modulate various cellular pathways and interact with different biomolecules. Additionally, Longistylin A may exhibit various pharmacological effects, making it a subject of research for potential therapeutic applications. As with many natural products, its efficacy and safety profile are subjects of ongoing investigation, highlighting the importance of further studies to fully understand its mechanisms and potential uses in medicine.
Formula:C20H22O2
InChI:InChI=1S/C20H22O2/c1-15(2)9-12-18-19(21)13-17(14-20(18)22-3)11-10-16-7-5-4-6-8-16/h4-11,13-14,21H,12H2,1-3H3/b11-10+
InChI key:InChIKey=MPDBOKIOROLWQP-ZHACJKMWSA-N
SMILES:O(C)C1=C(CC=C(C)C)C(O)=CC(/C=C/C2=CC=CC=C2)=C1
Synonyms:- 3-Methoxy-2-(3-methyl-2-buten-1-yl)-5-[(1E)-2-phenylethenyl]phenol
- Longistylin A
- LongistylinA
- Longistyline A
- Phenol, 3-methoxy-2-(3-methyl-2-butenyl)-5-[(1E)-2-phenylethenyl]-
- Phenol,3-methoxy-2-(3-methyl-2-butenyl)-5-(2-phenylethenyl)-, (E)-
- Phenol,3-methoxy-2-(3-methyl-2-butenyl)-5-[(1E)-2-phenylethenyl]- (9CI)
- Phenol, 3-methoxy-2-(3-methyl-2-buten-1-yl)-5-[(1E)-2-phenylethenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Longistyline A
CAS:Natural stilbene Longistyline A from Cajanus cajan leaves; antimicrobial against MRSA, MIC 1.56 μg/mL; neuroprotective.
Formula:C20H22O2Color and Shape:SolidMolecular weight:294.39Longistyline A
CAS:Longistyline A is a chemical compound classified as an isoquinoline alkaloid, which is derived from natural plant sources, specifically species within the Lauraceae family. This compound exhibits a mode of action characterized by its interaction with cellular pathways, potentially leading to apoptosis or cell cycle arrest in malignant cells. Through these mechanisms, Longistyline A interferes with the proliferation of cancerous cells, making it a compound of interest in the field of oncology research.Formula:C20H22O2Purity:Min. 95%Color and Shape:PowderMolecular weight:294.39 g/mol

