CAS 64099-82-7
:1-Propynyltri-n-butyltin
Description:
1-Propynyltri-n-butyltin, with the CAS number 64099-82-7, is an organotin compound characterized by the presence of a propynyl group bonded to a tri-n-butyltin moiety. This compound typically exhibits a colorless to pale yellow appearance and is known for its applications in various fields, including as a biocide and in polymer chemistry. The presence of the tin atom contributes to its unique properties, such as potential antimicrobial activity and stability in various chemical environments. Organotin compounds like this one are often studied for their environmental impact and toxicity, particularly in aquatic systems, due to their ability to bioaccumulate. Additionally, the propynyl group introduces unsaturation, which can influence the reactivity and interaction of the compound with other chemical species. Safety precautions are essential when handling this substance, as organotin compounds can pose health risks. Overall, 1-Propynyltri-n-butyltin is a notable example of organotin chemistry with specific industrial and environmental relevance.
Formula:C15H30Sn
InChI:InChI=1/3C4H9.C3H3.Sn/c3*1-3-4-2;1-3-2;/h3*1,3-4H2,2H3;1H3;/rC15H30Sn/c1-5-9-13-16(12-8-4,14-10-6-2)15-11-7-3/h5-7,9-11,13-15H2,1-4H3
SMILES:CCCC[Sn](C#CC)(CCCC)CCCC
Synonyms:- Propynyltri-n-butyltin
- Tributyl(Prop-1-Yn-1-Yl)Stannane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Propynyltri-n-butyltin, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C15H30SnPurity:96%Color and Shape:Clear colorless, LiquidMolecular weight:329.12Tributyl(prop-1-yn-1-yl)stannane
CAS:Formula:C15H30SnPurity:95%Color and Shape:LiquidMolecular weight:329.0997Tributyl(1-propynyl)tin
CAS:Tributyl(1-propynyl)tinFormula:C15H30SnPurity:98%Color and Shape: colourless liquidMolecular weight:329.11g/mol1-Propynyltributylstannane
CAS:Controlled Product1-Propynyltributylstannane is a fluorinated organotin compound that inhibits the uptake of chlorine by rat brain synaptosomes. It has been shown to antagonize the activities of ligands at the metabotropic glutamate receptor and n-propylpyridones. 1-Propynyltributylstannane also inhibits the uptake of fluorine in rat brain synaptosomes and has been patented for use as a pharmaceutical dosage.Formula:C15H30SnPurity:Min. 95%Molecular weight:329.11 g/mol



