CAS 641-12-3: Sennidin A
Description:Sennidin A, with the CAS number 641-12-3, is a naturally occurring compound classified as a glycoside. It is primarily derived from the leaves and pods of the Senna plant, particularly Senna alexandrina, which is known for its laxative properties. Sennidin A is characterized by its structure, which includes a sugar moiety linked to an aglycone, contributing to its biological activity. This compound exhibits mild laxative effects by stimulating peristalsis in the intestines, making it useful in herbal medicine for treating constipation. Additionally, Sennidin A is known for its potential antioxidant properties, which may contribute to its therapeutic effects. It is generally considered safe when used in appropriate doses, although excessive consumption can lead to gastrointestinal discomfort. As with many natural compounds, its efficacy and safety profile can vary based on individual health conditions and the presence of other substances. Overall, Sennidin A represents an important component of traditional herbal remedies, particularly in the context of digestive health.
Formula:C30H18O10
InChI:InChI=1/C30H18O10/c31-17-5-1-3-13-21(15-7-11(29(37)38)9-19(33)25(15)27(35)23(13)17)22-14-4-2-6-18(32)24(14)28(36)26-16(22)8-12(30(39)40)10-20(26)34/h1-10,21-22,31-34H,(H,37,38)(H,39,40)/t21-,22-/s2
InChI key:InChIKey=JPMRHWLJLNKRTJ-XHEJRLEYNA-N
SMILES:O=C(O)C1=CC(O)=C2C(=O)C=3C(O)=CC=CC3C(C2=C1)C4C=5C=CC=C(O)C5C(=O)C6=C(O)C=C(C=C64)C(=O)O
- Synonyms:
- (9R,9'R)-4,4',5,5'-tetrahydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid
- 1′,1,8′,8-Tetrahydroxy-10,10′-dihydroanthrone-3,3′-dicarboxylic acid
- Dihydroxydianthrone
- Sennidin A
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (9R,9′R)-rel-(+)-
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (R*,R*)-(+)-
- rel-(+)-(9R,9′R)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acid
- (R*,R*)-(+)-9,9',10,10'-Tetrahydro-4,4',5,5'-tetrahydroxy-10,10'-dioxo(9,9'-bianthracene)-2,2'-dicarboxylic acid
