CAS 641-68-9
:4-Carboxy-3-hydroxy-5-pentylphenyl 2,4-dihydroxy-6-pentylbenzoate
Description:
4-Carboxy-3-hydroxy-5-pentylphenyl 2,4-dihydroxy-6-pentylbenzoate, with the CAS number 641-68-9, is an organic compound that belongs to the class of benzoates. This substance features multiple functional groups, including carboxylic acid and hydroxyl groups, which contribute to its chemical reactivity and solubility properties. The presence of pentyl chains suggests that it has hydrophobic characteristics, which may influence its behavior in biological systems and its potential applications in various fields, such as pharmaceuticals or materials science. The compound's structure indicates that it may exhibit antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. Additionally, the arrangement of substituents on the aromatic rings may affect its stability and interaction with other molecules. Overall, this compound's unique combination of functional groups and hydrophobic characteristics makes it a subject of interest for further research and potential applications in various chemical and industrial processes.
Formula:C24H30O7
InChI:InChI=1S/C24H30O7/c1-3-5-7-9-15-11-17(25)13-19(26)22(15)24(30)31-18-12-16(10-8-6-4-2)21(23(28)29)20(27)14-18/h11-14,25-27H,3-10H2,1-2H3,(H,28,29)
InChI key:InChIKey=BEFYPHLCGVCBFF-UHFFFAOYSA-N
SMILES:C(OC1=CC(CCCCC)=C(C(O)=O)C(O)=C1)(=O)C2=C(CCCCC)C=C(O)C=C2O
Synonyms:- β-Resorcylic acid, 6-pentyl-, 4-(6-pentyl-β-resorcylate)
- 4-Carboxy-3-hydroxy-5-pentylphenyl 2,4-dihydroxy-6-pentylbenzoate
- b-Resorcylicacid, 6-pentyl-, 4-(6-pentyl-b-resorcylate) (7CI,8CI)
- Benzoic acid, 2,4-dihydroxy-6-pentyl-, 4-carboxy-3-hydroxy-5-pentylphenyl ester
- Anziaicacid (6CI)
- Anziaic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Anziaic acid
CAS:<p>Anziaic acid is a potent anticancer agent that has been isolated from human and Chinese urine. It is an analog of protein kinase inhibitors, which are known to induce apoptosis in cancer cells. Anziaic acid has been shown to inhibit the growth of leukemia and tumor cells by blocking the activity of kinases involved in cell proliferation. This medicinal compound has potential as an anticancer drug due to its ability to selectively target cancer cells while leaving healthy cells unharmed. Anziaic acid is a promising inhibitor for the development of novel cancer therapies.</p>Formula:C24H30O7Purity:Min. 95%Molecular weight:430.5 g/mol
