
CAS 641-90-7
:2-Hydroxyemodin
Description:
2-Hydroxyemodin, with the CAS number 641-90-7, is a naturally occurring anthraquinone derivative primarily found in certain plants, particularly in the genus Rheum. This compound is characterized by its hydroxyl group (-OH) at the 2-position of the anthraquinone structure, which contributes to its biological activity. It typically appears as a reddish-brown solid and is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial effects. The presence of the hydroxyl group enhances its solubility in polar solvents, making it more bioavailable. 2-Hydroxyemodin has been studied for its potential therapeutic applications, particularly in traditional medicine, and is of interest in the field of natural product chemistry. Its chemical structure allows for various interactions with biological molecules, which may contribute to its efficacy in different biological systems. As with many natural compounds, further research is necessary to fully understand its mechanisms of action and potential applications in medicine.
Formula:C15H10O6
InChI:InChI=1S/C15H10O6/c1-5-2-7-11(15(21)12(5)18)14(20)10-8(13(7)19)3-6(16)4-9(10)17/h2-4,16-18,21H,1H3
InChI key:InChIKey=LAOFTEMTSXNIIM-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC(O)=CC3O)=C(O)C(O)=C(C)C2
Synonyms:- 1,2,6,8-Tetrahydroxy-3-methylanthraquinone
- 2-Hydroxyemodin
- 9,10-Anthracenedione, 1,2,6,8-tetrahydroxy-3-methyl-
- 1,2,6,8-Tetrahydroxy-3-methyl-9,10-anthracenedione
- Alaternin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Alaternin
CAS:Alaternin is a natural product for research related to life sciences. The catalog number is TN5631 and the CAS number is 641-90-7.Formula:C15H10O6Purity:98%Color and Shape:SolidMolecular weight:286.239Alaternin
CAS:<p>Alaternin is a naturally occurring anthraquinone compound, which is sourced predominantly from plant species such as Rhamnus alaternus and various lichens. Its molecular structure comprises a quinone core, characteristic of secondary metabolites known for their diverse bioactivity. The mode of action of alaternin involves the disruption of microbial cellular processes, primarily by interfering with DNA replication and protein synthesis. This leads to a reduction in microbial proliferation, showcasing its potential as an antimicrobial agent. In scientific research, alaternin is utilized for its antimicrobial properties, making it a subject of interest in studies exploring novel antibiotic avenues. Its potential applications extend to biomedicine, where it may inform the development of new therapeutic agents to combat resistant strains of bacteria and other pathogens. Scientists investigate alaternin's role in natural product chemistry, seeking to understand its interactions and efficacy in various biological contexts. Its unique properties also demand evaluation in pharmacokinetic and pharmacodynamic studies to optimize its utility in medicinal applications.</p>Formula:C15H10O6Purity:Min. 95%Molecular weight:286.24 g/mol


