CAS 64106-78-1
:2-(2,6-dimethylphenoxy)acetohydrazide
Description:
2-(2,6-Dimethylphenoxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a phenoxy moiety. It features a 2,6-dimethylphenyl group attached to an acetohydrazide structure, which contributes to its potential biological activity. The presence of the hydrazide functional group suggests that it may participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of both hydrophobic (the aromatic ring) and hydrophilic (the hydrazide and acetyl groups) components. Its molecular structure may confer specific properties such as stability under certain conditions, and it may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-7-4-3-5-8(2)10(7)14-6-9(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:Cc1cccc(C)c1OCC(=NN)O
Synonyms:- Acetic Acid, 2-(2,6-Dimethylphenoxy)-, Hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(2,6-Dimethylphenoxy)acetohydrazide
CAS:2-(2,6-Dimethylphenoxy)acetohydrazide is a herbicide that inhibits the growth of monocotyledon and dicotyledon plants. It is used to control weeds in fields of soybeans, rice, corn, wheat, oats, barley and rye. The compound was found to be the most effective herbicide for the control of weeds in bioassays conducted with various types of plants. 2-(2,6-Dimethylphenoxy)acetohydrazide has been shown to inhibit the growth of Brassica species such as cabbage and broccoli by interfering with phenol synthesis.Formula:C10H14N2O2Purity:Min. 95%Molecular weight:194.24 g/mol
