CAS 64113-91-3
:TERT-BUTYL 2-AMINOBENZOATE
Description:
Tert-butyl 2-aminobenzoate, with the CAS number 64113-91-3, is an organic compound that belongs to the class of esters. It is characterized by the presence of a tert-butyl group and an amino group attached to a benzoate structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many esters. The presence of the amino group can impart basic properties, making it reactive in various chemical reactions, such as acylation or amidation. Tert-butyl 2-aminobenzoate may be utilized in organic synthesis, particularly in the preparation of pharmaceuticals or agrochemicals, due to its functional groups that can participate in further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H15NO2
InChI:InChI=1/C11H15NO2/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7H,2-3,8,12H2,1H3
SMILES:CCCCOC(=O)c1ccccc1N
Synonyms:- Tert-Butyl Anthranilate
- Butyl 2-Aminobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
tert-butyl 2-aminobenzoate
CAS:Formula:C11H15NO2Purity:96%Color and Shape:SolidMolecular weight:193.2423tert-Butyl 2-aminobenzoate
CAS:Formula:C11H15NO2Purity:95%Color and Shape:LiquidMolecular weight:193.246tert-Butyl 2-Aminobenzoate
CAS:Controlled ProductApplications tert-Butyl 2-Aminobenzoate is a useful reagent for preparing alkylamino quinazolinones.
References Lu, C., et al.: J. Org. Chem., 83, 1154 (2018)Formula:C11H15NO2Color and Shape:NeatMolecular weight:193.24tert-butyl 2-aminobenzoate
CAS:Controlled Producttert-Butyl 2-aminobenzoate is a synthetic compound that reacts with iodides to form tert-butyl 2-iodobenzoate. This reaction may be catalyzed by the addition of acids, bases, or Lewis acids. The sequence of this reaction is currently unknown.Formula:C11H15NO2Purity:Min. 95%Molecular weight:193.24 g/mol





