CAS 641144-16-3

(10-bromoanthracen-9-yl)boronic acid

Description:

(10-bromoanthracen-9-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an anthracene derivative. This compound features a bromine atom at the 10-position of the anthracene ring, which can influence its reactivity and electronic properties. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and materials science, particularly in Suzuki coupling reactions. The presence of the anthracene moiety imparts unique photophysical properties, allowing for potential applications in organic electronics, such as light-emitting diodes and solar cells. Additionally, the compound may exhibit interesting biological activity due to the structural characteristics of the anthracene core. Its solubility and stability in various solvents can vary, which is important for its practical applications. Overall, (10-bromoanthracen-9-yl)boronic acid is a versatile compound with significant potential in both synthetic chemistry and material science.

Formula: C₁₄H₁₀BBrO₂

InChI: InChI=1/C14H10BBrO2/c16-14-11-7-3-1-5-9(11)13(15(17)18)10-6-2-4-8-12(10)14/h1-8,17-18H

SMILES: c1ccc2c(c1)c(c1ccccc1c2Br)B(O)O

Synonyms:

• 10-Bromoanthracene-9-boronic acid

(10-Bromoanthracen-9-yl)boronic acid

CAS: 641144-16-3

Formula: C₁₄H₁₀BBrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.9430

Ref: IN-DA003DU2

10-Bromoanthracene-9-boronic acid

CAS: 641144-16-3

10-Bromoanthracene-9-boronic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.94g/mol

Ref: 54-OR360767

10-BROMOANTHRACENE-9-BORONIC ACID

CAS: 641144-16-3

Formula: C₁₄H₁₀BBrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 300.95

Ref: 10-F466927