CAS 64118-81-6: Diclofenac glucuronide
Description:Diclofenac glucuronide is a metabolite of the nonsteroidal anti-inflammatory drug (NSAID) diclofenac, which is commonly used to relieve pain and inflammation. This compound is formed through the conjugation of diclofenac with glucuronic acid, a process that enhances its solubility and facilitates excretion from the body. Diclofenac glucuronide is characterized by its relatively high polarity compared to its parent compound, which affects its pharmacokinetics and bioavailability. It is typically found in biological fluids, such as urine, following the administration of diclofenac. The compound exhibits anti-inflammatory properties, although it is less potent than diclofenac itself. Its presence in biological samples is often used as a biomarker for diclofenac exposure and can be relevant in pharmacokinetic studies. Additionally, understanding the characteristics of diclofenac glucuronide is important for assessing potential drug interactions and the overall metabolic pathway of diclofenac in the human body.
Formula:C20H19Cl2NO8
InChI:InChI=1S/C20H19Cl2NO8/c21-10-5-3-6-11(22)14(10)23-12-7-2-1-4-9(12)8-13(24)30-20-17(27)15(25)16(26)18(31-20)19(28)29/h1-7,15-18,20,23,25-27H,8H2,(H,28,29)/t15-,16-,17+,18-,20+/m0/s1
InChI key:InChIKey=JXIKYYSIYCILNG-HBWRTXEVSA-N
SMILES:O=C(O)C1OC(OC(=O)CC=2C=CC=CC2NC=3C(Cl)=CC=CC3Cl)C(O)C(O)C1O
- Synonyms:
- Diclofenac glucuronide
- Diclofenac-β-<span class="text-smallcaps">D</span>-glucuronide
- Diclofenacglucuronide
- β-<span class="text-smallcaps">D</span>-Glucopyranuronic acid, 1-[2-[(2,6-dichlorophenyl)amino]benzeneacetate]
- β-D-Glucopyranuronic acid, 1-[2-[(2,6-dichlorophenyl)amino]benzeneacetate]
- Diclofenac-β-D-glucuronide
