CAS 64123-77-9

Methyl 3-fluorophenylacetate

Description:

Methyl 3-fluorophenylacetate is an organic compound characterized by its ester functional group, which is formed from the reaction of 3-fluorophenylacetic acid and methanol. It features a methyl ester group attached to a 3-fluorophenyl ring, contributing to its unique chemical properties. The presence of the fluorine atom on the aromatic ring can influence the compound's reactivity and polarity, making it of interest in various chemical applications, including synthesis and medicinal chemistry. Methyl 3-fluorophenylacetate is typically a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents. Its molecular structure allows for potential interactions in biological systems, which may be explored in drug development or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.

Formula: C₉H₉FO₂

InChI: InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3

SMILES: COC(=O)Cc1cccc(c1)F

Methyl 2-(3-fluorophenyl)acetate

CAS: 64123-77-9

Formula: C₉H₉FO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 168.1650

Ref: IN-DA003AXQ

Methyl 3-fluorophenylacetate

CAS: 64123-77-9

Methyl 3-fluorophenylacetate

Formula: C₉H₉FO₂

Purity: 98%

Color and Shape: clear. faint lemon to lime liquid

Molecular weight: 168.16g/mol

Ref: 54-PC49079

Methyl 3-Fluorophenylacetate

CAS: 64123-77-9

Formula: C₉H₉FO₂

Purity: >98.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 168.17

Ref: 3B-M2536

Methyl 3-fluorophenylacetate

CAS: 64123-77-9

Formula: C₉H₉FO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 168.167

Ref: 10-F043036

Methyl 3-Fluorophenylacetate

CAS: 64123-77-9

Methyl 3-Fluorophenylacetate is an alkali, cyclopropene carboxamide that has a nucleophilic functionality. It is positioned strategically in biomolecular chemistry and biomolecular function. Methyl 3-Fluorophenylacetate has been used as a building block to synthesize bioactive molecules such as peptides and polymers. In addition, it can be used as a fluorescent probe for the identification of nucleophilic functionalities.

Formula: C₉H₉FO₂

Purity: Min. 95%

Molecular weight: 168.17 g/mol

Ref: 3D-PCA12377