CAS 64123-77-9
:Methyl 3-fluorophenylacetate
Description:
Methyl 3-fluorophenylacetate is an organic compound characterized by its ester functional group, which is formed from the reaction of 3-fluorophenylacetic acid and methanol. It features a methyl ester group attached to a 3-fluorophenyl ring, contributing to its unique chemical properties. The presence of the fluorine atom on the aromatic ring can influence the compound's reactivity and polarity, making it of interest in various chemical applications, including synthesis and medicinal chemistry. Methyl 3-fluorophenylacetate is typically a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents. Its molecular structure allows for potential interactions in biological systems, which may be explored in drug development or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C9H9FO2
InChI:InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3
SMILES:COC(=O)Cc1cccc(c1)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-(3-fluorophenyl)acetate
CAS:Formula:C9H9FO2Purity:96%Color and Shape:LiquidMolecular weight:168.1650Methyl 3-fluorophenylacetate
CAS:Methyl 3-fluorophenylacetateFormula:C9H9FO2Purity:>98.0%Color and Shape: clear. faint lemon to lime liquidMolecular weight:168.16g/molMethyl 3-Fluorophenylacetate
CAS:Formula:C9H9FO2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:168.17Methyl 3-fluorophenylacetate
CAS:Formula:C9H9FO2Purity:96%Color and Shape:LiquidMolecular weight:168.167Methyl 3-Fluorophenylacetate
CAS:Methyl 3-Fluorophenylacetate is an alkali, cyclopropene carboxamide that has a nucleophilic functionality. It is positioned strategically in biomolecular chemistry and biomolecular function. Methyl 3-Fluorophenylacetate has been used as a building block to synthesize bioactive molecules such as peptides and polymers. In addition, it can be used as a fluorescent probe for the identification of nucleophilic functionalities.
Formula:C9H9FO2Purity:Min. 95%Molecular weight:168.17 g/mol




