CAS 64133-79-5
:benzo[pqr]tetraphene-1,6-dione
Description:
Benzo[pqr]tetraphene-1,6-dione, with the CAS number 64133-79-5, is a polycyclic aromatic compound characterized by its fused ring structure, which consists of multiple benzene rings. This compound features two carbonyl (C=O) functional groups located at the 1 and 6 positions of the tetraphene framework, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of these carbonyl groups enhances its electron-accepting properties, making it useful in various electronic applications, including organic semiconductors and photovoltaic devices. Benzo[pqr]tetraphene-1,6-dione is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Its unique structure and properties make it a subject of interest in research related to organic electronics, photochemistry, and the development of advanced materials. Additionally, due to its polycyclic nature, it may exhibit interesting optical and electronic characteristics, which can be exploited in various technological applications.
Formula:C20H10O2
InChI:InChI=1/C20H10O2/c21-17-10-6-11-5-7-16-19-13(8-9-15(17)18(11)19)12-3-1-2-4-14(12)20(16)22/h1-10H
SMILES:c1ccc2c(c1)c1ccc3C(=O)C=Cc4ccc(c1c34)C2=O
Synonyms:- Benzo[A]Pyrene-1,6-Dione
- Benzo[a]pyrene-1,6-quinone
- Benzo[pqr]tetraphene-1,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
