CAS 64141-11-3

methyl 4-(4-methylbenzoyl)benzoate

Description:

Methyl 4-(4-methylbenzoyl)benzoate, with the CAS number 64141-11-3, is an organic compound that belongs to the class of esters. It is characterized by its aromatic structure, which includes a methyl group and a benzoyl moiety attached to a benzoate framework. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its pleasant fragrance, making it useful in the fragrance and flavor industry. Methyl 4-(4-methylbenzoyl)benzoate is also utilized in various chemical applications, including as a photoinitiator in polymerization processes. Its solubility is generally higher in organic solvents than in water, which is common for many aromatic esters. Additionally, it may exhibit certain biological activities, although specific toxicological data should be consulted for safety assessments. Overall, this compound is valued for its chemical properties and versatility in industrial applications.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-11-3-5-12(6-4-11)15(17)13-7-9-14(10-8-13)16(18)19-2/h3-10H,1-2H3

SMILES: Cc1ccc(cc1)C(=O)c1ccc(cc1)C(=O)OC

Methyl 4-(4-methylbenzoyl)benzoate

CAS: 64141-11-3

Methyl 4-(4-methylbenzoyl)benzoate

Purity: 95%

Molecular weight: 254.28g/mol

Ref: 54-OR480846