CAS 6415-12-9
:Tetramethylhydrazine
Description:
Tetramethylhydrazine (TMH) is a colorless, flammable liquid with a distinctive odor, primarily used as a rocket propellant and in various chemical syntheses. Its molecular formula is C4H10N2, indicating it contains four methyl groups attached to a hydrazine backbone. TMH is known for its high energy content and is classified as a hypergolic propellant, meaning it ignites spontaneously upon contact with an oxidizer, making it advantageous for certain aerospace applications. The substance is soluble in water and organic solvents, which can facilitate its use in various chemical processes. However, it is also considered toxic and potentially carcinogenic, necessitating careful handling and storage to minimize exposure. In terms of reactivity, TMH can undergo decomposition and may react with strong oxidizers, leading to hazardous situations. Its unique properties make it a subject of interest in both industrial applications and research within the field of energetic materials.
Formula:C4H12N2
InChI:InChI=1S/C4H12N2/c1-5(2)6(3)4/h1-4H3
InChI key:InChIKey=DHBZRQXIRAEMRO-UHFFFAOYSA-N
SMILES:N(N(C)C)(C)C
Synonyms:- 1,1,2,2-Tetramethylhydrazine
- 1,1,2,2-Tetramethylhydrazinium Chloride
- Hydrazine, 1,1,2,2-tetramethyl-
- Hydrazine, tetramethyl-
- Tetramethylhydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


