
CAS 6415-90-3
:Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrobromide (1:1)
Description:
Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrobromide (1:1), with CAS number 6415-90-3, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom within a bicyclo[3.2.1]octane framework. This compound features a benzeneacetic acid moiety, indicating the presence of a benzene ring attached to an acetic acid group, along with a hydroxymethyl group that contributes to its reactivity and potential biological activity. The hydrobromide salt form suggests that it is a protonated species, enhancing its solubility in polar solvents. The specific stereochemistry, indicated by the (3-endo) designation, implies a particular spatial arrangement of atoms that can influence the compound's interactions and properties. Overall, this compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry and drug development.
Formula:C17H23NO3·BrH
InChI:InChI=1/C17H23NO3.BrH/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;/h2-6,13-16,19H,7-11H2,1H3;1H/t13-,14+,15+,16?;
InChI key:InChIKey=VZDNSFSBCMCXSK-RIMUKSHENA-N
SMILES:O(C(C(CO)C1=CC=CC=C1)=O)[C@H]2C[C@@]3(N(C)[C@](C2)(CC3)[H])[H].Br
Synonyms:- 1αH,5αH-Tropan-3α-ol (±)-tropate (ester), hydrobromide
- Benzeneacetic acid, α-(hydroxymethyl)- 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester endo-(±)-, hydrobromide
- Benzeneacetic acid, α-(hydroxymethyl)- (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrobromide
- Benzeneacetic acid, α-(hydroxymethyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester endo-, hydrobromide
- Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Atropine hydrobromide
CAS:Atropine hydrobromide is a biochemical.Formula:C17H24BrNO3Color and Shape:SolidMolecular weight:370.28
