CAS 641569-94-0
:4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid
Description:
4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid, with the CAS number 641569-94-0, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a methyl group and an amino group linked to a pyrimidine and pyridine ring system. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. Its molecular structure suggests it may engage in hydrogen bonding due to the presence of the carboxylic acid group and the amino group, which can influence its reactivity and interactions with biological targets. The presence of heterocyclic rings (pyridine and pyrimidine) may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, its unique structural features suggest potential applications in pharmaceuticals or as a research chemical.
Formula:C17H14N4O2
InChI:InChI=1/C17H14N4O2/c1-11-4-5-12(16(22)23)9-15(11)21-17-19-8-6-14(20-17)13-3-2-7-18-10-13/h2-10H,1H3,(H,22,23)(H,19,20,21)
SMILES:Cc1ccc(cc1Nc1nccc(c2cccnc2)n1)C(=O)O
Synonyms:- 4-Methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}benzoic acid
- Benzoic acid, 4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-
- 4-Methyl-3-(4-pyridin-3-yl-pyrimidin-2-ylamino)-benzoic acid
- 4-Methyl-3-[(4-(3-Pyridinyl)-Pyrimidinyl)Amino]Benzoic Acid
- 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidiny]amino]benzoicacid
- 4-methyl-3-((4-(3-pyridinyl)-2-pyrimidinyl)amino)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Methyl-3-((4-(Pyridin-3-YL)Pyrimidin-2-YL)Amino)Benzoic Acid
CAS:Formula:C17H14N4O2Purity:97%Color and Shape:SolidMolecular weight:306.31874-Methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}benzoic acid
CAS:4-Methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}benzoic acidFormula:C17H14N4O2Purity:≥95%Color and Shape: pale yellow powderMolecular weight:306.32g/mol4-Methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:306.325012207031254-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid
CAS:Controlled ProductStability Hygroscopic
Applications 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid is used in the preparation of (pyridinyl)-N-[(triazolyl)phenyl]pyrimidinamine derivatives and (pyridinyl)-N-[oxadiazolyl)phenyl]pyrimidinamine derivatives, and can be used in the detection of their activity as antileukemia agents (neoplastic stem cell leukemia). 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid is also a Nilotinib (N465300) intermediate, which might be useful in treatment of chronic myelogenous leukemia.
References Li, Y., et al.: Bioorg. Med. Chem. Lett., 26, 1419-1427 (2016)Formula:C17H14N4O2Color and Shape:NeatMolecular weight:306.324-Methyl-3[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid
CAS:Please enquire for more information about 4-Methyl-3[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C17H14N4O2Purity:Min. 95%Molecular weight:306.32 g/mol







