CymitQuimica logo

CAS 641571-05-3

:

4-Methyl-N-[3-(2-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzamide

Description:
4-Methyl-N-[3-(2-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzamide, with CAS number 641571-05-3, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, aromatic rings, and heterocycles. This compound is notable for its potential biological activity, particularly in the field of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals targeting specific biological pathways. The presence of trifluoromethyl and imidazole groups suggests that it may exhibit unique electronic properties and interactions, enhancing its efficacy and selectivity in biological systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by its structural features, making it a subject of interest for further research and development. Overall, this compound exemplifies the intricate design often found in drug discovery, where modifications to molecular structure can significantly impact biological activity and therapeutic potential.
Formula:C28H22F3N7O
InChI:InChI=1S/C28H22F3N7O/c1-17-5-6-19(12-25(17)37-27-34-9-7-24(36-27)20-4-3-8-32-16-20)26(39)35-22-13-21(28(29,30)31)14-23(15-22)38-11-10-33-18(38)2/h3-16H,1-2H3,(H,35,39)(H,34,36,37)
InChI key:InChIKey=XQFCGCJOYHNELC-UHFFFAOYSA-N
SMILES:CC=1N(C2=CC(C(F)(F)F)=CC(NC(=O)C3=CC(NC=4N=C(C=CN4)C=5C=CC=NC5)=C(C)C=C3)=C2)C=CN1
Synonyms:
  • Benzamide, 4-methyl-N-[3-(2-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-
  • 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-N-[5-(2-methyl-1H-imidazol-1-yl)-3-(trifluoromethyl)phenyl]benzamide
  • 4-Methyl-N-[3-(2-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.