CAS 641571-11-1
:5-(4-Methyl-1H-imidazol-1-yl)-3-(trifluoromethyl)benzenamine
Description:
5-(4-Methyl-1H-imidazol-1-yl)-3-(trifluoromethyl)benzenamine, with the CAS number 641571-11-1, is a chemical compound characterized by its unique structure that includes a trifluoromethyl group and an imidazole moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The imidazole ring contributes to its potential as a ligand in coordination chemistry and may also impart specific biological properties, such as antimicrobial or antifungal activity. Additionally, the presence of the methyl group on the imidazole ring can affect the compound's sterics and electronic properties, influencing its reactivity and interactions with other molecules. Overall, this compound's unique structural features make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C11H10F3N3
InChI:InChI=1S/C11H10F3N3/c1-7-5-17(6-16-7)10-3-8(11(12,13)14)2-9(15)4-10/h2-6H,15H2,1H3
InChI key:InChIKey=WWTGXYAJVXKEKL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(N)C1)N2C=C(C)N=C2
Synonyms:- 1-(3-Amino-5-trifluoromethylphenyl)-4-methylimidazole
- 3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)benzenamine
- 3-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline
- 3-(4-Methyl-imidazol-1-yl)-5-trifluoro-methylphenylamine
- 3-(4-Methyl-imidazole-1-yl)-5-trifluoro methylphenylamine
- 3-(4-Methylimidazol-1-yl)-5-trifluoromethylphenylamine
- 3-(trifluoromethyl)-5-(4-methyl-1H-imidazol-1-yl)benzenamine
- 5-(4-Methyl-1H-imidazol-1-yl)-3-(trifluoromethyl)benzenamine
- 5-(4-Methyl-1H-imidazol-1-yl)-3-(trifluoromethyl)benzeneamine
- Benzenamine, 3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline
CAS:Formula:C11H10F3N3Purity:>98.0%(GC)(T)Color and Shape:White to Light gray to Light yellow powder to crystalMolecular weight:241.22Nilotinib Related Compound A (3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline)
CAS:<p>Compounds containing an unfused imidazole ring, whether or not hydrogenated, in the structure, nesoi</p>Formula:C11H10F3N3Color and Shape:Beige PowderMolecular weight:241.082683-Amino-5-(4-methyl-1H-imidazol-1-yl)benzotrifluoride
CAS:<p>3-Amino-5-(4-methyl-1H-imidazol-1-yl)benzotrifluoride</p>Purity:99%Color and Shape:Pale Yellow SolidMolecular weight:241.21g/molNilotinib EP Impurity A (Nilotinib USP Related Compound A)
CAS:Formula:C11H10F3N3Color and Shape:White To Off-White SolidMolecular weight:241.223-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline
CAS:Controlled Product<p>Applications Intermediate in the preparation of Nilotinib.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Zhang, G., et al.: Bioorg. Med. Chem. Lett., 19, 6691 (2009), Seeliger, M., et al.: Cancer Res., 69, 2384 (2009),<br></p>Formula:C11H10F3N3Color and Shape:NeatMolecular weight:241.213-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline
CAS:Formula:C11H10F3N3Purity:98%Color and Shape:SolidMolecular weight:241.2173-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline
CAS:<p>3-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline (MTIA) is a diazotization agent that is used in the industrial production of nilotinib, an anti-cancer drug. MTIA reacts with ethyl acetate to form ethyl 3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline, which can then be reacted with hydrochloric acid to produce MTIA hydrochloride. The MTIA hydrochloride can be dissolved in water and used as a diazotization agent. The sequence of these reactions is: 3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline + ethyl acetate → ethyl 3-(4-methyl--1H--</p>Formula:C11H10F3N3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:241.21 g/mol










