
CAS 641571-14-4
:1,1-Dimethylethyl N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate
Description:
1,1-Dimethylethyl N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate, with CAS number 641571-14-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a dimethyl group, an imidazole ring, and a trifluoromethyl group, which contribute to its unique chemical properties. The imidazole moiety is known for its biological activity, often found in pharmaceuticals, while the trifluoromethyl group enhances lipophilicity and metabolic stability. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its potential applications could span various fields, including agrochemicals and pharmaceuticals, due to its structural characteristics that may influence biological activity. Safety and handling precautions are essential, as with many chemical substances, to mitigate any risks associated with exposure. Further studies would be necessary to fully understand its reactivity, stability, and potential applications in various chemical processes.
Formula:C16H18F3N3O2
InChI:InChI=1S/C16H18F3N3O2/c1-10-8-22(9-20-10)13-6-11(16(17,18)19)5-12(7-13)21-14(23)24-15(2,3)4/h5-9H,1-4H3,(H,21,23)
InChI key:InChIKey=XSSQAAHBIVFYGC-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(NC(OC(C)(C)C)=O)C1)N2C=NC(C)=C2
Synonyms:- Carbamic acid, [3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-, 1,1-dimethylethyl ester
- Carbamic acid, N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-, 1,1-dimethylethyl ester
- [3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamic acid 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

