
CAS 6417-50-1
:N1,N4-Bis[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]-1,4-benzenedicarboxamide
Description:
N1,N4-Bis[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]-1,4-benzenedicarboxamide, commonly referred to by its CAS number 6417-50-1, is a synthetic organic compound characterized by its complex structure, which includes anthracene and benzamide moieties. This compound exhibits notable properties such as strong fluorescence and potential applications in photodynamic therapy and as a dye due to its conjugated system. Its molecular structure contributes to its stability and reactivity, making it of interest in various chemical and biological studies. The presence of multiple functional groups, including amide and carbonyl groups, enhances its ability to form hydrogen bonds, influencing its solubility and interaction with biological targets. Additionally, the compound's unique arrangement of aromatic rings may provide interesting electronic properties, which can be exploited in materials science and organic electronics. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of drug design and photophysical applications.
Formula:C50H30N4O8
InChI:InChI=1S/C50H30N4O8/c55-43-33-17-9-21-37(41(33)45(57)31-15-7-19-35(39(31)43)51-47(59)27-11-3-1-4-12-27)53-49(61)29-23-25-30(26-24-29)50(62)54-38-22-10-18-34-42(38)46(58)32-16-8-20-36(40(32)44(34)56)52-48(60)28-13-5-2-6-14-28/h1-26H,(H,51,59)(H,52,60)(H,53,61)(H,54,62)
InChI key:InChIKey=KGZMABLDPNAGFQ-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(C(NC2=C3C(C(=O)C=4C(C3=O)=CC=CC4NC(=O)C5=CC=CC=C5)=CC=C2)=O)C=C1)C6=C7C(C(=O)C=8C(C7=O)=CC=CC8NC(=O)C9=CC=CC=C9)=CC=C6
Synonyms:- C.I. 65425
- 1,4-Benzenedicarboxamide, N1,N4-bis[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]-
- 1,4-Benzenedicarboxamide, N,N′-bis[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]-
- N1,N4-Bis[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]-1,4-benzenedicarboxamide
- Terephthalamide, N,N′-bis(5-benzamido-1-anthraquinonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Vat Yellow 13
CAS:Vat Yellow 13 is a yellow dye.Formula:C50H30N4O8Color and Shape:SolidMolecular weight:814.8
