CAS 64175-51-5

2-(benzofuran-3-yl)acetic acid

Description:

2-(Benzofuran-3-yl)acetic acid, with the CAS number 64175-51-5, is an organic compound characterized by its benzofuran moiety attached to an acetic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water may be limited due to its hydrophobic benzofuran structure. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the benzofuran ring can engage in π-π stacking interactions, which may influence its biological activity and interactions with other molecules. This compound is of interest in medicinal chemistry and pharmacology, as benzofuran derivatives often exhibit diverse biological activities, including anti-inflammatory and analgesic effects. However, specific biological properties and applications would require further investigation and research to fully understand its potential uses in various fields.

Formula: C₁₀H₈O₃

InChI: InChI=1/C10H8O3/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6H,5H2,(H,11,12)

SMILES: c1ccc2c(c1)c(CC(=O)O)co2

Synonyms:

• 1-Benzofuran-3-ylacetic acid
• 2-(Benzofuran-3-yl)aceticacid
• 3-Benzofuranacetic Acid
• Benzo[B]Furan-3-Ylacetic Acid

Benzo[b]furan-3-ylacetic acid

CAS: 64175-51-5

Formula: C₁₀H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA00ECXC

(Benzo[b]furan-3-yl)acetic acid

CAS: 64175-51-5

(Benzo[b]furan-3-yl)acetic acid

Formula: C₁₀H₈O₃

Purity: 97%

Color and Shape: light brown crystals

Molecular weight: 176.17g/mol

Ref: 54-OR9145

2-(Benzofuran-3-yl)acetic acid

CAS: 64175-51-5

Formula: C₁₀H₈O₃

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 176.171

Ref: 10-F092952