CAS 6418-41-3
:3-methyltridecane
Description:
3-Methyltridecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It consists of a straight-chain of thirteen carbon atoms with a methyl group (–CH₃) attached to the third carbon, resulting in a total of fourteen carbon atoms. Its molecular formula is C₁₄H₃₀, indicating it is saturated with hydrogen atoms. This compound is typically a colorless liquid at room temperature and is insoluble in water due to its nonpolar nature, but it is soluble in organic solvents. 3-Methyltridecane is part of the larger family of alkanes, which are known for their relatively low reactivity, making them stable under standard conditions. It has applications in various fields, including as a component in fuels and lubricants, and may also be used in research related to hydrocarbon behavior and properties. Its physical and chemical properties, such as boiling point and density, are influenced by its molecular structure and the presence of the methyl group, which can affect its branching and overall characteristics.
Formula:C14H30
InChI:InChI=1/C14H30/c1-4-6-7-8-9-10-11-12-13-14(3)5-2/h14H,4-13H2,1-3H3
Synonyms:- tridecane, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
