CAS 6418-95-7

2,3-dichloro-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide

Description:

2,3-Dichloro-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide, with the CAS number 6418-95-7, is a chemical compound that belongs to the class of benzamides. This substance features a dichloro substitution on the benzene ring, which enhances its reactivity and potential biological activity. The presence of the benzoxazole moiety contributes to its structural complexity and may impart specific pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The compound is likely to exhibit moderate to high lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the dichloro and benzoxazole groups may play a role in the compound's mechanism of action, potentially affecting its efficacy and safety profile. As with many synthetic organic compounds, proper handling and safety measures are essential due to potential toxicity or environmental impact.

Formula: C₂₁H₁₄Cl₂N₂O₂

InChI: InChI=1/C21H14Cl2N2O2/c1-12-8-9-18-17(10-12)25-21(27-18)13-4-2-5-14(11-13)24-20(26)15-6-3-7-16(22)19(15)23/h2-11H,1H3,(H,24,26)

SMILES: Cc1ccc2c(c1)nc(c1cccc(c1)N=C(c1cccc(c1Cl)Cl)O)o2

Synonyms:

• benzamide, 2,3-dichloro-N-[3-(5-methyl-2-benzoxazolyl)phenyl]-

(2R)-1-(((2-Aminoethoxy)(hydroxy)phosphoryl)oxy)-3-(stearoyloxy)propan-2-yl oleate

CAS: 6418-95-7

(2R)-1-(((2-Aminoethoxy)(hydroxy)phosphoryl)oxy)-3-(stearoyloxy)propan-2-yl oleate

Purity: 99%

Molecular weight: 746.06g/mol

Ref: 54-OR1066738

1-Stearoyl-2-oleoyl-sn-glycero-3-phosphoethanolamine

CAS: 6418-95-7

1-Stearoyl-2-oleoyl-sn-glycero-3-phosphoethanolamine is a monomolecular lipid molecule that exhibits significant interactions with the surface of a cell. It can form a monolayer on the surface of cells and has been shown to enhance cancer therapy in mice, as well as other studies involving adrenergic receptors. This molecule can be used for efficient methods that are thermodynamically more favorable than those currently available.

Formula: C₂₁H₁₄Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 397.2 g/mol

Ref: 3D-GAA41895