CAS 64182-61-2
:1-Chloro-3-fluoro-2-nitrobenzene
Description:
1-Chloro-3-fluoro-2-nitrobenzene is an aromatic compound characterized by the presence of a nitro group, a chlorine atom, and a fluorine atom attached to a benzene ring. Its molecular structure features a nitro group (-NO2) at the second position, a chlorine atom (-Cl) at the first position, and a fluorine atom (-F) at the third position of the benzene ring, making it a substituted nitrobenzene derivative. This compound is typically a pale yellow solid at room temperature and is known for its moderate solubility in organic solvents. It exhibits properties typical of halogenated aromatic compounds, including potential reactivity in electrophilic substitution reactions. The presence of both electron-withdrawing groups (the nitro and halogen substituents) influences its chemical behavior, making it a useful intermediate in organic synthesis and in the production of various chemical products. Safety precautions should be taken when handling this compound, as it may pose health risks due to its toxic and potentially hazardous nature.
Formula:C6H3ClFNO2
InChI:InChI=1S/C6H3ClFNO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H
InChI key:InChIKey=GOIUPLBHNRTTIO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Cl)C=CC=C1F
Synonyms:- 1-Chloro-3-fluoro-2-nitrobenzene
- 264-723-5
- Benzene, 1-chloro-3-fluoro-2-nitro-
- 2-Chloro-6-fluoronitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-6-fluoronitrobenzene
CAS:Formula:C6H3ClFNO2Purity:97%Color and Shape:SolidMolecular weight:175.54492-Chloro-6-fluoronitrobenzene
CAS:2-Chloro-6-fluoronitrobenzeneFormula:C6H3ClFNO2Purity:≥95%Color and Shape: yellow fused solidMolecular weight:175.54g/mol2-Chloro-6-fluoronitrobenzene
CAS:2-Chloro-6-fluoronitrobenzene is an aromatic compound that has been used as a versatile building block in the synthesis of complex compounds. It is also used as a research chemical, reaction component, and speciality chemical. This compound has been shown to be useful for the preparation of pharmaceuticals, agrochemicals, and other organic compounds. 2-Chloro-6-fluoronitrobenzene is a colorless liquid with a boiling point of 130 degrees Celsius at atmospheric pressure. It has many uses in research and industry due to its versatility and high quality.Formula:C6H3ClFNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:175.54 g/mol2-Chloro-6-fluoronitrobenzene
CAS:Formula:C6H3ClFNO2Purity:98%Color and Shape:SolidMolecular weight:175.54



