CAS 64185-12-2

tributyl(3,3,3-trifluoroprop-1-yn-1-yl)stannane

Description:

Tributyl(3,3,3-trifluoroprop-1-yn-1-yl)stannane is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and a 3,3,3-trifluoroprop-1-yn-1-yl moiety. This compound typically exhibits a high degree of lipophilicity due to the butyl groups, which can enhance its solubility in organic solvents. The trifluoroprop-1-yn-1-yl group introduces significant electronegativity and reactivity, making the compound potentially useful in various chemical reactions, particularly in organic synthesis and materials science. Organotin compounds are known for their applications in catalysis, as stabilizers, and in the production of polymers. However, they also raise environmental and health concerns due to their toxicity and potential bioaccumulation. Proper handling and disposal are essential to mitigate risks associated with exposure. Overall, tributyl(3,3,3-trifluoroprop-1-yn-1-yl)stannane represents a unique combination of properties that can be leveraged in specialized chemical applications.

Formula: C₁₅H₂₇F₃Sn

InChI: InChI=1/3C4H9.C3F3.Sn/c3*1-3-4-2;1-2-3(4,5)6;/h3*1,3-4H2,2H3;;/rC15H27F3Sn/c1-4-7-11-19(12-8-5-2,13-9-6-3)14-10-15(16,17)18/h4-9,11-13H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)C#CC(F)(F)F

Synonyms:

• Stannane, tributyl(3,3,3-trifluoro-1-propyn-1-yl)-
• Tributyl(3,3,3-trifluoroprop-1-yn-1-yl)stannane

1-Tributylstannyl-3,3,3-trifluoro-1-propyne

Controlled Product

CAS: 64185-12-2

1-Tributylstannyl-3,3,3-trifluoro-1-propyne is an organic solvent that can be used as a reagent in the trifluoromethylation of hexane and diazomethane. It has been shown to be regioselective in the 1,3-dipolar cycloaddition of acetonitrile and oxide. It also reacts efficiently with aryl groups to produce yields.

Formula: C₁₅H₂₇F₃Sn

Purity: Min. 95%

Molecular weight: 383.08 g/mol

Ref: 3D-FT164761