CAS 64188-97-2

3-AMINO-4-PYRIDINECARBOXAMIDE

Description:

3-Amino-4-pyridinecarboxamide, with the CAS number 64188-97-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the pyridine ring, contributing to its polar nature and potential for hydrogen bonding. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, which enhances its reactivity in various chemical reactions. The presence of both amino and carboxamide functional groups suggests that it may exhibit basic and acidic properties, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. Additionally, its structure allows for potential interactions with biological systems, which could be explored for medicinal chemistry purposes. Overall, 3-amino-4-pyridinecarboxamide is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₇N₃O

InChI: InChI=1/C6H7N3O/c7-5-3-9-2-1-4(5)6(8)10/h1-3H,7H2,(H2,8,10)

SMILES: c1cncc(c1C(=O)N)N

Synonyms:

• 3-Aminoisonicotinamide
• 3-Amino-4-Carbamoylpyridine

3-AMINO-4-PYRIDINECARBOXAMIDE

CAS: 64188-97-2

Formula: C₆H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.1393

Ref: IN-DA00EAHO

3-Aminoisonicotinamide

CAS: 64188-97-2

3-Aminoisonicotinamide

Purity: 98%

Color and Shape: Yellow Solid

Molecular weight: 137.14g/mol

Ref: 54-OR2138

3-Aminopyridine-4-carboxamide

CAS: 64188-97-2

Purity: 92%

Molecular weight: 137.139

Ref: FT-A12440

3-Aminoisonicotinamide

CAS: 64188-97-2

Formula: C₆H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.142

Ref: 10-F068367