CAS 6419-69-8
:4-chloro-N-(2-hydroxyethyl)benzenesulfonamide
Description:
4-Chloro-N-(2-hydroxyethyl)benzenesulfonamide, with the CAS number 6419-69-8, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a chloro substituent on the benzene ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a hydroxyethyl group enhances its solubility in polar solvents and may influence its biological activity. Typically, sulfonamides exhibit a range of pharmacological effects, including antimicrobial activity, making them significant in the development of pharmaceuticals. The compound's structure suggests it may interact with biological systems through hydrogen bonding and other intermolecular forces, which can affect its efficacy and safety profile. Additionally, the chlorine atom may impart unique electronic properties, influencing the compound's reactivity and interactions with other molecules. Overall, 4-chloro-N-(2-hydroxyethyl)benzenesulfonamide is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its potential applications.
Formula:C8H10ClNO3S
InChI:InChI=1/C8H10ClNO3S/c9-7-1-3-8(4-2-7)14(12,13)10-5-6-11/h1-4,10-11H,5-6H2
SMILES:c1cc(ccc1Cl)S(=O)(=O)NCCO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-N-(2-hydroxyethyl)benzenesulfonamide
CAS:Formula:C8H10ClNO3SColor and Shape:SolidMolecular weight:235.6879
