CAS 64190-70-1
:phe-met-arg-phe amide
Description:
Phe-met-arg-phe amide, also known as a peptide, is a synthetic compound composed of four amino acids: phenylalanine (Phe), methionine (Met), arginine (Arg), and another phenylalanine (Phe), with an amide functional group at the terminal end. This compound is characterized by its specific sequence of amino acids, which influences its biological activity and properties. Peptides like this one can exhibit various functions, including roles in signaling, hormone activity, and as potential therapeutic agents. The presence of the aromatic phenylalanine residues contributes to hydrophobic interactions, while the positively charged arginine can engage in electrostatic interactions, affecting the peptide's solubility and stability. Additionally, the methionine residue may play a role in redox reactions due to its sulfur-containing side chain. The amide bond at the terminal end enhances the stability of the peptide against enzymatic degradation. Overall, the characteristics of phe-met-arg-phe amide make it a subject of interest in biochemical research and potential pharmaceutical applications.
Formula:C29H42N8O4S
InChI:InChI=1/C29H42N8O4S/c1-42-16-14-23(35-26(39)21(30)17-19-9-4-2-5-10-19)28(41)36-22(13-8-15-34-29(32)33)27(40)37-24(25(31)38)18-20-11-6-3-7-12-20/h2-7,9-12,21-24H,8,13-18,30H2,1H3,(H2,31,38)(H,35,39)(H,36,41)(H,37,40)(H4,32,33,34)/t21-,22-,23-,24-/m0/s1
SMILES:CSCC[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccccc1)N)O
Synonyms:- FMRF Amide
- 6-O--D-Glucopyranosyl-D-glucitol
- L-phenylalanylmethionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
- L-phenylalanyl-L-methionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-N-((S)-1-Amino-1-oxo-3-phenylpropan-2-yl)-2-((S)-2-((S)-2-amino-3-phenylpropanamido)-4-(methylthio)butanamido)-5-guanidinopentanamide
CAS:Formula:C29H42N8O4SMolecular weight:598.7600Phe-Met-Arg-Phe, amide
CAS:Phe-Met-Arg-Phe amide activates K+ current in neurons (ED50=23 nM), co-localizes with neuropeptide Y in brain regions.Formula:C29H42N8O4SPurity:98%Color and Shape:SolidMolecular weight:598.76FMRF-Amide
CAS:A molluscan cardioexcitatory neuropeptide which has the potential to be used in cell biology, pharmacological, and protein-protein interaction studies. This product is available as an FMRF-Amide.
Formula:C29H42N8O4SPurity:Min. 95%Molecular weight:598.76 g/mol


