
CAS 64192-68-3
:(αS)-α-Amino-4-hydroxy-3,6-dioxo-1,4-cyclohexadiene-1-propanoic acid
Description:
(αS)-α-Amino-4-hydroxy-3,6-dioxo-1,4-cyclohexadiene-1-propanoic acid, with the CAS number 64192-68-3, is an amino acid derivative characterized by its unique cyclohexadiene structure. This compound features a propanoic acid moiety, which contributes to its acidic properties, and multiple functional groups, including an amino group and hydroxyl group, which enhance its reactivity and potential for forming hydrogen bonds. The presence of dioxo groups indicates that it may participate in various chemical reactions, including oxidation and coordination with metal ions. Its stereochemistry, denoted by the (αS) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with enzymes or receptors. This compound may be of interest in biochemical research, particularly in studies related to metabolic pathways or as a potential precursor in the synthesis of more complex molecules. Overall, its structural features suggest a versatile role in both synthetic and biological chemistry contexts.
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,13H,1,10H2,(H,14,15)/t5-/m0/s1
InChI key:InChIKey=AGMJSPIGDFKRRO-YFKPBYRVSA-N
SMILES:C([C@@H](C(O)=O)N)C=1C(=O)C=C(O)C(=O)C1
Synonyms:- p-Topaquinone
- 1,4-Cyclohexadiene-1-propanoic acid, α-amino-4-hydroxy-3,6-dioxo-, (S)-
- (αS)-α-Amino-4-hydroxy-3,6-dioxo-1,4-cyclohexadiene-1-propanoic acid
- 1,4-Cyclohexadiene-1-propanoic acid, α-amino-4-hydroxy-3,6-dioxo-, (αS)-
- TPQ
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
