CAS 641993-09-1

5-chloro-8-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

Description:

5-Chloro-8-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a synthetic organic compound belonging to the class of quinolines, which are bicyclic aromatic compounds. This substance features a chloro group and a carboxylic acid functional group, contributing to its reactivity and potential biological activity. The presence of the methyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound is characterized by its ability to form hydrogen bonds due to the carboxylic acid, which can enhance solubility in polar solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's unique arrangement of functional groups may also allow for interactions with biological targets, making it of interest in drug discovery. As with many quinoline derivatives, it may exhibit fluorescence properties, which can be useful in various analytical applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₁H₈ClNO₃

InChI: InChI=1/C11H8ClNO3/c1-5-2-3-7(12)8-9(5)13-4-6(10(8)14)11(15)16/h2-4H,1H3,(H,13,14)(H,15,16)

SMILES: Cc1ccc(c2c1[nH]cc(c2=O)C(=O)O)Cl

Synonyms:

• 3-Quinolinecarboxylic Acid, 5-Chloro-4-Hydroxy-8-Methyl-
• 5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid

5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid

CAS: 641993-09-1

5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid

Purity: ≥95%

Molecular weight: 237.64g/mol

Ref: 54-OR183485