CAS 642-00-2
:hexa-O-acetyl-D-mannitol
Description:
Hexa-O-acetyl-D-mannitol is a chemical compound that belongs to the class of sugar alcohols, specifically a derivative of D-mannitol. It is characterized by the presence of six acetyl groups attached to the hydroxyl groups of the mannitol molecule, which enhances its lipophilicity and stability compared to its parent compound. This modification can influence its solubility and reactivity, making it useful in various applications, including pharmaceuticals and biochemistry. Hexa-O-acetyl-D-mannitol is typically a white crystalline solid, and it is soluble in organic solvents such as chloroform and acetone, but less soluble in water due to the acetylation. The compound is often used as a protecting group in organic synthesis, particularly in carbohydrate chemistry, to prevent unwanted reactions during chemical transformations. Its CAS number, 642-00-2, is a unique identifier that facilitates the identification and regulation of this substance in scientific literature and databases.
Formula:C18H26O12
InChI:InChI=1/C18H26O12/c1-9(19)25-7-15(27-11(3)21)17(29-13(5)23)18(30-14(6)24)16(28-12(4)22)8-26-10(2)20/h15-18H,7-8H2,1-6H3/t15-,16-,17-,18-/m1/s1
SMILES:CC(=O)OC[C@H]([C@H]([C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- D-Mannitol hexaacetate
- 1,2,3,4,5,6-hexa-O-acetylhexitol
- 1,2,3,4,5,6-hexa-O-acetyl-D-mannitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2,3,4,5,6-Hexa-O-acetyl-D-mannitol
CAS:1, 2, 3, 4, 5, 6-Hexa-O-acetyl-D-mannitol (1,2,3,4,5,6-HOM) is a glycoside that belongs to the group of pentose sugars. It is the only natural hexose sugar that contains an acetate residue in its structure. 1,2,3,4,5,6-HOM is found in plants and animals and has been shown to have anti-cancer properties. The reaction products of 1 with various enzymes are also studied for their cancer inhibitory effects. This molecule has also been shown to inhibit lipid peroxidation in mitochondria. 1,2,3,4,5,6-HOM binds to cell surface receptors on cancer cells and inhibits growth by inhibiting the synthesis of DNA and RNA.Formula:C18H26O12Purity:Min. 95%Color and Shape:PowderMolecular weight:434.39 g/mol
