CAS 642-91-1

2,1-Benzisoxazole-3-carboxylic acid

Description:

2,1-Benzisoxazole-3-carboxylic acid, with the CAS number 642-91-1, is an organic compound characterized by its bicyclic structure that incorporates both an isoxazole and a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 2,1-Benzisoxazole-3-carboxylic acid is of interest in various fields, including medicinal chemistry, due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its derivatives may also exhibit significant pharmacological effects, making it a subject of research in drug development. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula: C₈H₅NO₃

InChI: InChI=1/C8H5NO3/c10-8(11)7-5-3-1-2-4-6(5)9-12-7/h1-4H,(H,10,11)

SMILES: c1ccc2c(c1)c(C(=O)O)on2

Synonyms:

• 2,1-Benzoxazole-3-carboxylic acid

2,1-benzoxazole-3-carboxylic acid

CAS: 642-91-1

Formula: C₈H₅NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.1302

Ref: IN-DA0039YT

2,1-Benzisoxazole-3-carboxylic acid

CAS: 642-91-1

2,1-Benzisoxazole-3-carboxylic acid

Formula: C₈H₅NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 163.13g/mol

Ref: 54-OR8019

Benzo[c]isoxazole-3-carboxylic acid

CAS: 642-91-1

Formula: C₈H₅NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 163.132

Ref: 10-F226310

2,1-benzisoxazole-3-carboxylic acid

CAS: 642-91-1

2,1-benzisoxazole-3-carboxylic acid (BIX) is a small molecule with antimicrobial and anticancer activity. It has been shown to be selective against candidum, a fungus that causes oral thrush in humans. BIX has also been shown to suppress the growth of plasmodium, the malaria parasite that causes malaria. This compound is synthesized by diazo coupling of 2-aminobenzoic acid and benzisoxazole with potassium carbonate and potassium chloride. BIX has also been shown to have an antiplasmodial effect against Plasmodium falciparum, the most virulent form of this parasite, which is responsible for more than 90% of deaths from malaria. The mechanism of action is not yet known but may be due to inhibition of protein synthesis or inhibition of mitochondrial function.

Formula: C₈H₅NO₃

Purity: Min. 95%

Molecular weight: 163.13 g/mol

Ref: 3D-AAA64291