CAS 64201-64-5
:quinoline N-oxide hydrate
Description:
Quinoline N-oxide hydrate is a chemical compound derived from quinoline, characterized by the presence of an N-oxide functional group. It typically appears as a crystalline solid and is known for its solubility in polar solvents, such as water and alcohols, due to the hydrophilic nature of the N-oxide group. This compound is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the study of oxidation processes. Quinoline N-oxide hydrate exhibits moderate toxicity and should be handled with care in laboratory settings. Its molecular structure contributes to its reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, including antimicrobial properties, which has garnered interest in medicinal chemistry. As with many chemical substances, proper safety protocols should be followed when working with quinoline N-oxide hydrate to mitigate any potential health risks.
Formula:C9H9NO2
InChI:InChI=1/C9H7NO.H2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H;1H2
SMILES:c1ccc2c(c1)cccn2=O.O
Synonyms:- Quinoline 1-Oxide Hydrate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Quinoline N-Oxide Hydrate
CAS:Formula:C9H7NO·xH2OPurity:>97.0%(T)Color and Shape:White to Brown powder to crystalMolecular weight:145.16 (as Anhydrous)Quinoline N-oxide hydrate
CAS:Formula:C9H9NO2Purity:97%Color and Shape:SolidMolecular weight:163.1733Quinoline N-oxide hydrate
CAS:Quinoline N-oxide hydratePurity:97%Color and Shape:SolidMolecular weight:163.17g/molQuinoline N-oxide hydrate, 97% (dry wt.), water ca 20%
CAS:Quinoline N-oxide hydrate is used in quantitative determination of nitrones using trifluoroacetic anhydride-sodium iodide reagent. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy
Formula:C9H7NOPurity:97%Color and Shape:Cream to pale brown, Crystals or powder or crystalline powderMolecular weight:145.16




