CAS 6422-35-1

Z-Gly-Gly-NH2

Description:

Z-Gly-Gly-NH2, also known as Z-Glycylglycine amide, is a dipeptide derivative characterized by the presence of two glycine residues linked by a peptide bond, with a protective Z (benzyloxycarbonyl) group at the amino terminus and an amide group at the carboxy terminus. This compound is typically used in peptide synthesis and research due to its stability and ability to serve as a building block for more complex peptides. The Z group protects the amino group from unwanted reactions during synthesis, making it a valuable intermediate in organic chemistry. Z-Gly-Gly-NH2 is soluble in polar solvents, such as water and methanol, and exhibits properties typical of peptides, including the ability to form hydrogen bonds and participate in various biochemical interactions. Its CAS number, 6422-35-1, allows for easy identification in chemical databases. As with many peptides, it may exhibit biological activity, although specific applications would depend on the context of its use in research or therapeutic settings.

Formula: C₁₂H₁₅N₃O₄

InChI: InChI=1/C12H15N3O4/c13-10(16)6-14-11(17)7-15-12(18)19-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,13,16)(H,14,17)(H,15,18)

SMILES: c1ccc(cc1)COC(=NCC(=NCC(=N)O)O)O

Synonyms:

• N-[(benzyloxy)carbonyl]glycylglycinamide

Benzyl (2-((2-amino-2-oxoethyl)amino)-2-oxoethyl)carbamate

CAS: 6422-35-1

Formula: C₁₂H₁₅N₃O₄

Purity: %

Molecular weight: 265.2652

Ref: IN-DA00EC7K

Z-Gly-Gly-NH2

CAS: 6422-35-1

Z-Gly-Gly-NH2 is a synthetic peptide that has been shown to inhibit the activity of phosphatases, which are enzymes that hydrolyze phosphate groups from phosphorylated substrates. It is a hydrophobic and metal chelator, which makes it suitable for use in chromaffin cells and dorsal root ganglia. Z-Gly-Gly-NH2 has been shown to be specific for inhibition of synaptic phosphatase (PP1). This compound also inhibits the enzyme inhibitor subtilisin, which is found in bacteria such as Streptomyces or Bacillus subtilis. Z-Gly-Gly-NH2 has been shown to have a high affinity for receptors.

Formula: C₁₂H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 265.27 g/mol

Ref: 3D-FG111465