CAS 64224-60-8

5-Bromo-4-pyrimidinecarboxylic acid

Description:

5-Bromo-4-pyrimidinecarboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a carboxylic acid functional group at the 4-position contributes to its chemical reactivity and potential applications. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in the synthesis of pharmaceuticals and agrochemicals. The compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Additionally, its bromine substituent may impart unique biological activities, making it of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₅H₃BrN₂O₂

InChI: InChI=1S/C5H3BrN2O2/c6-3-1-7-2-8-4(3)5(9)10/h1-2H,(H,9,10)

InChI key: InChIKey=HZZBITVSVYFOND-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=CN=CN1

Synonyms:

• 4-Pyrimidinecarboxylic Acid, 5-Bromo-
• 5-Bromo-4-pyrimidinecarboxylic acid
• 5-Bromo-4-pyrimidinecarboxylicacid
• 5-Bromopyrimidine-4-carboxylic acid

5-bromopyrimidine-4-carboxylic acid

CAS: 64224-60-8

Formula: C₅H₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 202.9935

Ref: IN-DA0036YH

5-Bromopyrimidine-4-carboxylic acid

CAS: 64224-60-8

5-Bromopyrimidine-4-carboxylic acid

Purity: 97%

Molecular weight: 202.99g/mol

Ref: 54-OR323224

5-Bromo-4-pyrimidinecarboxylic acid

CAS: 64224-60-8

Formula: C₅H₃BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.995

Ref: 10-F079970