CAS 64236-23-3
:2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione
Description:
2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione, commonly known as a derivative of naphthoquinone, is a chemical compound characterized by its complex structure that includes a naphthalene ring system and a long aliphatic side chain. This compound typically exhibits properties associated with naphthoquinones, such as strong UV-Vis absorbance due to its conjugated double bond system, which can contribute to its potential applications in photochemistry and as a dye. The presence of the long alkyl chain enhances its lipophilicity, making it more soluble in organic solvents than in water. This characteristic can influence its behavior in biological systems and its interactions with membranes. Additionally, the methyl groups in the structure can affect its steric properties and reactivity. Overall, this compound may be of interest in various fields, including materials science, organic synthesis, and potentially in biological applications, although specific studies on its biological activity and toxicity may be limited.
Formula:C31H48O2
InChI:InChI=1S/C31H48O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-19,22-25H,9-17,20-21H2,1-6H3
InChI key:InChIKey=XOQNYHSBHIIJMQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C(C)=C1CCC(CCCC(CCCC(CCCC(C)C)C)C)C)=CC=CC2
Synonyms:- 1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)-
- 1,4-Naphthoquinone, 2-methyl-3-(3,7,11,15-tetramethylcetyl)-
- 1,4-Naphthoquinone, 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)-
- 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Beta,Gamma-Dihydro Vitamin K1
CAS:Controlled ProductFormula:C31H48O2Color and Shape:NeatMolecular weight:452.71β,γ-Dihydro vitamin K1
CAS:β,γ-Dihydro vitamin K1 is a reduced form of vitamin K1, a fat-soluble vitamin derived from plant sources such as leafy greens and certain oils. This compound plays a crucial role in the biochemical pathway related to the activation of clotting factors in the blood. The reduction of vitamin K1 to β,γ-Dihydro vitamin K1 is vital as it facilitates the carboxylation of specific glutamic acid residues on these proteins, which is essential for their functional activity.
Formula:C31H48O2Purity:Min. 95%Molecular weight:452.7 g/mol


