CAS 6424-06-2

N-{[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl}-2-methylbenzamide

Description:

N-{[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl}-2-methylbenzamide, identified by its CAS number 6424-06-2, is a chemical compound characterized by its complex structure, which includes a benzoxazole moiety and a carbamothioyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential fluorescence due to the presence of the benzoxazole ring. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the ethoxy and methyl groups can influence its solubility and reactivity, potentially enhancing its interaction with biological targets. Additionally, the compound's thioamide functionality may contribute to its chemical reactivity, allowing for various synthetic applications. Overall, this substance is notable for its structural complexity and potential utility in medicinal chemistry, although specific physical and chemical properties such as melting point, solubility, and spectral data would require empirical determination or literature reference for precise characterization.

Formula: C₂₄H₂₁N₃O₃S

InChI: InChI=1/C24H21N3O3S/c1-3-29-18-11-8-16(9-12-18)23-26-20-14-17(10-13-21(20)30-23)25-24(31)27-22(28)19-7-5-4-6-15(19)2/h4-14H,3H2,1-2H3,(H2,25,27,28,31)

SMILES: CCOc1ccc(cc1)c1nc2cc(ccc2o1)N=C(N=C(c1ccccc1C)O)S

Synonyms:

• benzamide, N-[[[2-(4-ethoxyphenyl)-5-benzoxazolyl]amino]thioxomethyl]-2-methyl-

17-Hydroxy-19-nor-5a,17a-pregn-20-en-3-one

Controlled Product

CAS: 6424-06-2

Applications 17-Hydroxy-19-nor-5α,17α-pregn-20-en-3-one is used in the synthesis of 19-nordihydrotestosterone derivatives that serve as anti-estrogenic compounds.
References Bowers, A. et al.: J. Am. Chem. Soc., 79, 4556 (1957);

Formula: C₂₀H₃₀O₂

Color and Shape: Neat

Molecular weight: 302.45

Ref: TR-H948755